CAS 5778-78-9 is the registry number for 5-Methyl-1,2,3,4-tetrahydroacridin-9-amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-methyl-1,2,3,4-tetrahydroacridin-9-amine (CAS 5778-78-9) is a chemical compound with the molecular formula C14H16N2 and a molecular weight of 212.29 g/mol. IUPAC name: 5-methyl-1,2,3,4-tetrahydroacridin-9-amine. InChIKey: GODLIFKIXOXQIS-UHFFFAOYSA-N.
| Molecular formula | C14H16N2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | 5-methyl-1,2,3,4-tetrahydroacridin-9-amine |
| InChIKey | GODLIFKIXOXQIS-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=C3CCCCC3=N2)N |
Computed by PubChem (NCBI)