CAS 57785-35-0 is the registry number for 5-Bromo-n,n-diethyl-2-furamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-bromo-N,N-diethylfuran-2-carboxamide (CAS 57785-35-0) is a chemical compound with the molecular formula C9H12BrNO2 and a molecular weight of 246.10 g/mol. IUPAC name: 5-bromo-N,N-diethylfuran-2-carboxamide. InChIKey: RHIMTYOEEOGBLQ-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO2 |
|---|---|
| Molecular weight | 246.10 g/mol |
| IUPAC name | 5-bromo-N,N-diethylfuran-2-carboxamide |
| InChIKey | RHIMTYOEEOGBLQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC=C(O1)Br |
Computed by PubChem (NCBI)