CAS 578021-55-3 appears in our catalog under these names: Methyl n-boc-4-ethylpiperidine-4-carboxylate, 95%, 1-tert-Butyl 4-methyl 4-ethylpiperidine-1,4-dicarboxylate, 95-<97%, 1-tert-Butyl 4-methyl 4-ethylpiperidine-1,4-dicarboxylate, ≥97-<99%, Methyl n–boc–4–ethylpiperidine–4–carboxylate, 1-tert-Butyl 4-methyl 4-ethylpiperidine-1,4-dicarboxylate, 97%+(GC-MS),RG, 97%+(GC-MS),RG. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 50g, 100g, 200g, 300g, 400g.
1-O-tert-butyl 4-O-methyl 4-ethylpiperidine-1,4-dicarboxylate (CAS 578021-55-3) is a chemical compound with the molecular formula C14H25NO4 and a molecular weight of 271.35 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 4-ethylpiperidine-1,4-dicarboxylate. InChIKey: XTVJBGBETZFXJR-UHFFFAOYSA-N.
| Molecular formula | C14H25NO4 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl 4-ethylpiperidine-1,4-dicarboxylate |
| InChIKey | XTVJBGBETZFXJR-UHFFFAOYSA-N |
| SMILES | CCC1(CCN(CC1)C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)