CAS 57870-03-8 is the registry number for Ethyl 4-(trifluoromethyl)benzene-1-carboximidate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Ethyl 4-(trifluoromethyl)benzenecarboximidate (CAS 57870-03-8) is a chemical compound with the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. IUPAC name: ethyl 4-(trifluoromethyl)benzenecarboximidate. InChIKey: OQWJBTBBKXKOEA-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO |
|---|---|
| Molecular weight | 217.19 g/mol |
| IUPAC name | ethyl 4-(trifluoromethyl)benzenecarboximidate |
| InChIKey | OQWJBTBBKXKOEA-UHFFFAOYSA-N |
| SMILES | CCOC(=N)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)