CAS 57928-72-0 is the registry number for 3-(Phenoxymethyl)benzonitrile, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g.
3-(phenoxymethyl)benzonitrile (CAS 57928-72-0) is a chemical compound with the molecular formula C14H11NO and a molecular weight of 209.24 g/mol. IUPAC name: 3-(phenoxymethyl)benzonitrile. InChIKey: CCCLIXBSUZNVSN-UHFFFAOYSA-N.
| Molecular formula | C14H11NO |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 3-(phenoxymethyl)benzonitrile |
| InChIKey | CCCLIXBSUZNVSN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=CC(=CC=C2)C#N |
Computed by PubChem (NCBI)