CAS 57963-09-4 is the registry number for 6-Benzylpyridin-2-amine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
6-benzylpyridin-2-amine (CAS 57963-09-4) is a chemical compound with the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. IUPAC name: 6-benzylpyridin-2-amine. InChIKey: HVYIQDPDESDLFU-UHFFFAOYSA-N.
| Molecular formula | C12H12N2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | 6-benzylpyridin-2-amine |
| InChIKey | HVYIQDPDESDLFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=CC=C2)N |
Computed by PubChem (NCBI)