CAS 57999-11-8 is the registry number for 4-(p-Tolyl)-1H-pyrazol-5-amine 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
4-(4-methylphenyl)-1H-pyrazol-5-amine (CAS 57999-11-8) is a chemical compound with the molecular formula C10H11N3 and a molecular weight of 173.21 g/mol. IUPAC name: 4-(4-methylphenyl)-1H-pyrazol-5-amine. InChIKey: VNDBRCBZFIAMRE-UHFFFAOYSA-N.
| Molecular formula | C10H11N3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 4-(4-methylphenyl)-1H-pyrazol-5-amine |
| InChIKey | VNDBRCBZFIAMRE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(NN=C2)N |
Computed by PubChem (NCBI)