Products 58048-37-6

CAS 58048-37-6 is the registry number for 2-(2,4-Dichlorophenoxy)propanoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(2,4-dichlorophenoxy)propanoyl chloride (CAS 58048-37-6) is a chemical compound with the molecular formula C9H7Cl3O2 and a molecular weight of 253.5 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)propanoyl chloride. InChIKey: ONQSXERGNKDILF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7Cl3O2
Molecular weight253.5 g/mol
IUPAC name2-(2,4-dichlorophenoxy)propanoyl chloride
InChIKeyONQSXERGNKDILF-UHFFFAOYSA-N
SMILESCC(C(=O)Cl)OC1=C(C=C(C=C1)Cl)Cl

Computed by PubChem (NCBI)