CAS 73981-96-1 appears in our catalog under these names: Ethyl 2,4,6-trichlorobenzoate 98%, Ethyl 2,4,6-trichlorobenzoate, 98%, 98%, ETHYL 2,4,6-TRICHLOROBENZOATE, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
Ethyl 2,4,6-trichlorobenzoate (CAS 73981-96-1) is a chemical compound with the molecular formula C9H7Cl3O2 and a molecular weight of 253.5 g/mol. IUPAC name: ethyl 2,4,6-trichlorobenzoate. InChIKey: RUTZFTVBPCFIIQ-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl3O2 |
|---|---|
| Molecular weight | 253.5 g/mol |
| IUPAC name | ethyl 2,4,6-trichlorobenzoate |
| InChIKey | RUTZFTVBPCFIIQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)