Products 581072-18-6
CAS 581072-18-6 is the registry number for (E)-2,4,5-trifluorobenzaldehyde oxime, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(NE)-N-[(2,4,5-trifluorophenyl)methylidene]hydroxylamine (CAS 581072-18-6) is a chemical compound with the molecular formula C7H4F3NO and a molecular weight of 175.11 g/mol. IUPAC name: (NE)-N-[(2,4,5-trifluorophenyl)methylidene]hydroxylamine. InChIKey: OXRQCBOUXWHFPA-QDEBKDIKSA-N.
| Molecular formula | C7H4F3NO |
|---|---|
| Molecular weight | 175.11 g/mol |
| IUPAC name | (NE)-N-[(2,4,5-trifluorophenyl)methylidene]hydroxylamine |
| InChIKey | OXRQCBOUXWHFPA-QDEBKDIKSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)/C=N/O |
Computed by PubChem (NCBI)