CAS 58176-56-0 is the registry number for 6-Methoxy-2,3-dimethyl-1H-indole, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methoxy-2,3-dimethyl-1H-indole (CAS 58176-56-0) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 6-methoxy-2,3-dimethyl-1H-indole. InChIKey: DIDHRCLBBYWTTC-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 6-methoxy-2,3-dimethyl-1H-indole |
| InChIKey | DIDHRCLBBYWTTC-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C=CC(=C2)OC)C |
Computed by PubChem (NCBI)