CAS 5818-84-8 appears in our catalog under these names: Adrenochrome Impurity 1, Adrenochrome Bisulfite Sodium Salt, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
Sodium 3-hydroxy-1-methyl-5,6-dioxo-3,4-dihydro-2H-indole-3a-sulfonate (CAS 5818-84-8) is a chemical compound with the molecular formula C9H10NNaO6S and a molecular weight of 283.24 g/mol. IUPAC name: sodium 3-hydroxy-1-methyl-5,6-dioxo-3,4-dihydro-2H-indole-3a-sulfonate. InChIKey: XGQUULFLRVRLPY-UHFFFAOYSA-M.
| Molecular formula | C9H10NNaO6S |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | sodium 3-hydroxy-1-methyl-5,6-dioxo-3,4-dihydro-2H-indole-3a-sulfonate |
| InChIKey | XGQUULFLRVRLPY-UHFFFAOYSA-M |
| SMILES | CN1CC(C2(C1=CC(=O)C(=O)C2)S(=O)(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)