CAS 98930-06-4 is the registry number for (S)-2-Amino-3-(4-(sulfooxy)phenyl)propanoic acid, sodium salt, 95% Disodium Salt, 95% Disodium Salt. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Sodium [4-[(2S)-2-amino-2-carboxyethyl]phenyl] sulfate (CAS 98930-06-4) is a chemical compound with the molecular formula C9H10NNaO6S and a molecular weight of 283.24 g/mol. IUPAC name: sodium [4-[(2S)-2-amino-2-carboxyethyl]phenyl] sulfate. InChIKey: BSGUVYQJXDWSSQ-QRPNPIFTSA-M.
| Molecular formula | C9H10NNaO6S |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | sodium [4-[(2S)-2-amino-2-carboxyethyl]phenyl] sulfate |
| InChIKey | BSGUVYQJXDWSSQ-QRPNPIFTSA-M |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)N)OS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)