CAS 581813-14-1 is the registry number for 1-[3-Fluoro-4-(trifluoromethyl)phenyl]ethan-1-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[3-fluoro-4-(trifluoromethyl)phenyl]ethanamine (CAS 581813-14-1) is a chemical compound with the molecular formula C9H9F4N and a molecular weight of 207.17 g/mol. IUPAC name: 1-[3-fluoro-4-(trifluoromethyl)phenyl]ethanamine. InChIKey: JGOIWTAAYYAMKP-UHFFFAOYSA-N.
| Molecular formula | C9H9F4N |
|---|---|
| Molecular weight | 207.17 g/mol |
| IUPAC name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]ethanamine |
| InChIKey | JGOIWTAAYYAMKP-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)C(F)(F)F)F)N |
Computed by PubChem (NCBI)