CAS 690653-23-7 appears in our catalog under these names: ([3-Fluoro-5-(trifluoromethyl)phenyl]methyl)(methyl)amine, 95%, {(3-Fluoro-5-(trifluoromethyl)phenyl)methyl}(methyl)amine, 1-(3-Fluoro-5-(trifluoromethyl)phenyl)-N-methylmethanamine, 97%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 0,5g, 50mg, 250mg.
1-[3-fluoro-5-(trifluoromethyl)phenyl]-N-methylmethanamine (CAS 690653-23-7) is a chemical compound with the molecular formula C9H9F4N and a molecular weight of 207.17 g/mol. IUPAC name: 1-[3-fluoro-5-(trifluoromethyl)phenyl]-N-methylmethanamine. InChIKey: BSHXOUCKAXRBEP-UHFFFAOYSA-N.
| Molecular formula | C9H9F4N |
|---|---|
| Molecular weight | 207.17 g/mol |
| IUPAC name | 1-[3-fluoro-5-(trifluoromethyl)phenyl]-N-methylmethanamine |
| InChIKey | BSHXOUCKAXRBEP-UHFFFAOYSA-N |
| SMILES | CNCC1=CC(=CC(=C1)F)C(F)(F)F |
Computed by PubChem (NCBI)