CAS 58246-82-5 appears in our catalog under these names: 3,6-Dibromo-9-methyl-9H-carbazole, 95%, 95%, 3,6-Dibromo-9-methyl-9H-carbazole. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3,6-dibromo-9-methylcarbazole (CAS 58246-82-5) is a chemical compound with the molecular formula C13H9Br2N and a molecular weight of 339.02 g/mol. IUPAC name: 3,6-dibromo-9-methylcarbazole. InChIKey: SAYMLKNOCKBPMK-UHFFFAOYSA-N.
| Molecular formula | C13H9Br2N |
|---|---|
| Molecular weight | 339.02 g/mol |
| IUPAC name | 3,6-dibromo-9-methylcarbazole |
| InChIKey | SAYMLKNOCKBPMK-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Br)C3=C1C=CC(=C3)Br |
Computed by PubChem (NCBI)