CAS 69297-87-6 is the registry number for 2,7-Dibromo-9-methyl-9H-carbazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,7-dibromo-9-methylcarbazole (CAS 69297-87-6) is a chemical compound with the molecular formula C13H9Br2N and a molecular weight of 339.02 g/mol. IUPAC name: 2,7-dibromo-9-methylcarbazole. InChIKey: KFDXVWQGXLZIFO-UHFFFAOYSA-N.
| Molecular formula | C13H9Br2N |
|---|---|
| Molecular weight | 339.02 g/mol |
| IUPAC name | 2,7-dibromo-9-methylcarbazole |
| InChIKey | KFDXVWQGXLZIFO-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)Br)C3=C1C=C(C=C3)Br |
Computed by PubChem (NCBI)