CAS 58249-69-7 is the registry number for 5,6–Dimethoxybenzo(d)thiazole. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
5,6-dimethoxy-1,3-benzothiazole (CAS 58249-69-7) is a chemical compound with the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. IUPAC name: 5,6-dimethoxy-1,3-benzothiazole. InChIKey: HYXKRZZFKJHDRT-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2S |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | 5,6-dimethoxy-1,3-benzothiazole |
| InChIKey | HYXKRZZFKJHDRT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=CS2)OC |
Computed by PubChem (NCBI)