Products 58262-06-9
CAS 58262-06-9 is the registry number for 2,5-Dimethoxy-d6-4-methyl-benzene. Offered by: TRC, MedChemExpress. Available pack sizes: 500mg, 50mg, 25 mg, 50 mg, 100 mg, 500 mg.
2-methyl-1,4-bis(trideuteriomethoxy)benzene (CAS 58262-06-9) is a chemical compound with the molecular formula C9H12O2 and a molecular weight of 158.23 g/mol. IUPAC name: 2-methyl-1,4-bis(trideuteriomethoxy)benzene. InChIKey: IQISOVKPFBLQIQ-XERRXZQWSA-N.
| Molecular formula | C9H12O2 |
|---|---|
| Molecular weight | 158.23 g/mol |
| IUPAC name | 2-methyl-1,4-bis(trideuteriomethoxy)benzene |
| InChIKey | IQISOVKPFBLQIQ-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=C(C=C1)OC([2H])([2H])[2H])C |
Computed by PubChem (NCBI)