Products 58263-53-9
CAS 58263-53-9 is the registry number for Isobutyl 4-chloro-3,5-dinitrobenzoate, 97%. Offered by: BLDpharm, Fluorochem. Available pack sizes: 25g, 100g.
2-methylpropyl 4-chloro-3,5-dinitrobenzoate (CAS 58263-53-9) is a chemical compound with the molecular formula C11H11ClN2O6 and a molecular weight of 302.67 g/mol. IUPAC name: 2-methylpropyl 4-chloro-3,5-dinitrobenzoate. InChIKey: MHWMKXCBVGGVSX-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O6 |
|---|---|
| Molecular weight | 302.67 g/mol |
| IUPAC name | 2-methylpropyl 4-chloro-3,5-dinitrobenzoate |
| InChIKey | MHWMKXCBVGGVSX-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)C1=CC(=C(C(=C1)[N+](=O)[O-])Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
2-methylpropyl 4-chloro-3,5-dinitrobenzoate, Isobutyl 4-chloro-3,5-dinitrobenzoate, Isobutyl 3,5-dinitro-4-chlorobenzoate, 4-Chloro-3,5-dinitro-benzoic acid isobutyl ester, isobutyl-3,5-dinitro-4-chlorobenzoate, C11H11ClN2O6, Isobutyl4-chloro-3,5-dinitrobenzoate, isobutyl 4-chloro-3,5-dinitro-benzoate