CAS 58271-37-7 is the registry number for N,N'-Bis(2,4-dimethylphenyl)propanediamide. Offered by: Biosynth. Available pack sizes: 2,5g.
N,N'-bis(2,4-dimethylphenyl)propanediamide (CAS 58271-37-7) is a chemical compound with the molecular formula C19H22N2O2 and a molecular weight of 310.4 g/mol. IUPAC name: N,N'-bis(2,4-dimethylphenyl)propanediamide. InChIKey: YUUSRGBUOGLRPE-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | N,N'-bis(2,4-dimethylphenyl)propanediamide |
| InChIKey | YUUSRGBUOGLRPE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)CC(=O)NC2=C(C=C(C=C2)C)C)C |
Computed by PubChem (NCBI)