Products 58273-34-0
CAS 58273-34-0 is the registry number for 3-((4-((3-oxocyclohex-1-enyl)amino)phenyl)amino)cyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-[4-[(3-oxocyclohexen-1-yl)amino]anilino]cyclohex-2-en-1-one (CAS 58273-34-0) is a chemical compound with the molecular formula C18H20N2O2 and a molecular weight of 296.4 g/mol. IUPAC name: 3-[4-[(3-oxocyclohexen-1-yl)amino]anilino]cyclohex-2-en-1-one. InChIKey: JNTGSSDHXGEQQX-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | 3-[4-[(3-oxocyclohexen-1-yl)amino]anilino]cyclohex-2-en-1-one |
| InChIKey | JNTGSSDHXGEQQX-UHFFFAOYSA-N |
| SMILES | C1CC(=CC(=O)C1)NC2=CC=C(C=C2)NC3=CC(=O)CCC3 |
Computed by PubChem (NCBI)