CAS 58282-50-1 is the registry number for 5-Acetyloxyethyl-2-hydroxypheny Ethanone. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
2-(3-acetyl-4-hydroxyphenyl)ethyl acetate (CAS 58282-50-1) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 2-(3-acetyl-4-hydroxyphenyl)ethyl acetate. InChIKey: DCGRLMABSSGAPH-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 2-(3-acetyl-4-hydroxyphenyl)ethyl acetate |
| InChIKey | DCGRLMABSSGAPH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)CCOC(=O)C)O |
Computed by PubChem (NCBI)