CAS 58314-81-1 is the registry number for 3-Methyl-1,4-diphenyl-1H-pyrazol-5-amine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-methyl-1,4-diphenylpyrazol-5-amine (CAS 58314-81-1) is a chemical compound with the molecular formula C16H15N3 and a molecular weight of 249.31 g/mol. IUPAC name: 3-methyl-1,4-diphenylpyrazol-5-amine. InChIKey: DMKCZUXCQWLBOI-UHFFFAOYSA-N.
| Molecular formula | C16H15N3 |
|---|---|
| Molecular weight | 249.31 g/mol |
| IUPAC name | 3-methyl-1,4-diphenylpyrazol-5-amine |
| InChIKey | DMKCZUXCQWLBOI-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1C2=CC=CC=C2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)