CAS 921061-16-7 is the registry number for 2-(4-Methylphenyl)-1,3-thiazole-5-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(4-methylphenyl)-1,3-thiazole-5-carbaldehyde (CAS 921061-16-7) is a chemical compound with the molecular formula C11H9NOS and a molecular weight of 203.26 g/mol. IUPAC name: 2-(4-methylphenyl)-1,3-thiazole-5-carbaldehyde. InChIKey: RYJVUGRGDUNLMS-UHFFFAOYSA-N.
| Molecular formula | C11H9NOS |
|---|---|
| Molecular weight | 203.26 g/mol |
| IUPAC name | 2-(4-methylphenyl)-1,3-thiazole-5-carbaldehyde |
| InChIKey | RYJVUGRGDUNLMS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC=C(S2)C=O |
Computed by PubChem (NCBI)