Products 58359-53-8

CAS 58359-53-8 appears in our catalog under these names: 4-Phenylazobenzenesulfonyl chloride, 95%, Azobenzene–4–sulfonyl Chloride, Azobenzene-4-sulfonyl Chloride, >98.0%(T), 4-Phenylazobenzenesulfonyl Chloride. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-phenyldiazenylbenzenesulfonyl chloride (CAS 58359-53-8) is a chemical compound with the molecular formula C12H9ClN2O2S and a molecular weight of 280.73 g/mol. IUPAC name: 4-phenyldiazenylbenzenesulfonyl chloride. InChIKey: UEAZPVORQYDKHZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9ClN2O2S
Molecular weight280.73 g/mol
IUPAC name4-phenyldiazenylbenzenesulfonyl chloride
InChIKeyUEAZPVORQYDKHZ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N=NC2=CC=C(C=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)