CAS 854035-93-1 is the registry number for N-(3-Chlorophenyl)-n-(4-formyl-1,3-thiazol-2-yl)acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-(3-chlorophenyl)-N-(4-formyl-1,3-thiazol-2-yl)acetamide (CAS 854035-93-1) is a chemical compound with the molecular formula C12H9ClN2O2S and a molecular weight of 280.73 g/mol. IUPAC name: N-(3-chlorophenyl)-N-(4-formyl-1,3-thiazol-2-yl)acetamide. InChIKey: PBBRLJUFVBUNIC-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O2S |
|---|---|
| Molecular weight | 280.73 g/mol |
| IUPAC name | N-(3-chlorophenyl)-N-(4-formyl-1,3-thiazol-2-yl)acetamide |
| InChIKey | PBBRLJUFVBUNIC-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C1=CC(=CC=C1)Cl)C2=NC(=CS2)C=O |
Computed by PubChem (NCBI)