Products 5840-03-9
CAS 5840-03-9 appears in our catalog under these names: N1-Phenylbenzene-1,3-diamine, 95%, N1-Phenylbenzene-1,3-diamine 95%, N1-Phenylbenzene-1,3-diamine, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 50mg, 100mg, 250mg.
3-N-phenylbenzene-1,3-diamine (CAS 5840-03-9) is a chemical compound with the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. IUPAC name: 3-N-phenylbenzene-1,3-diamine. InChIKey: VJTZHXQAZLGBHV-UHFFFAOYSA-N.
| Molecular formula | C12H12N2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | 3-N-phenylbenzene-1,3-diamine |
| InChIKey | VJTZHXQAZLGBHV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC(=C2)N |
Computed by PubChem (NCBI)
Synonyms:
N1-Phenyl-1,3-benzenediamine, N1-Phenylbenzene-1,3-diamine, n-(m-aminophenyl)aniline, N-Phenyl-benzene-1,3-diamine, N-phenylbenzene-1,3-diamine, N-(3-Aminophenyl)-N-phenylamine, 3-N-phenylbenzene-1,3-diamine, 1,3-Benzenediamine, N-phenyl-, N~1~-Phenylbenzene-1,3-diamine, (3-aminophenyl)phenylamine