CAS 5845-60-3 appears in our catalog under these names: (3S,6R)-3-Methyl-6-(2-methylpropyl)piperazine-2,5-dione, 95%, (3S,6R)-3-Methyl-6-(2-methylpropyl)piperazine-2,5-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(3S,6R)-3-methyl-6-(2-methylpropyl)piperazine-2,5-dione (CAS 5845-60-3) is a chemical compound with the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. IUPAC name: (3S,6R)-3-methyl-6-(2-methylpropyl)piperazine-2,5-dione. InChIKey: DBJPZCJQDRPOME-NKWVEPMBSA-N.
| Molecular formula | C9H16N2O2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | (3S,6R)-3-methyl-6-(2-methylpropyl)piperazine-2,5-dione |
| InChIKey | DBJPZCJQDRPOME-NKWVEPMBSA-N |
| SMILES | C[C@H]1C(=O)N[C@@H](C(=O)N1)CC(C)C |
Computed by PubChem (NCBI)