CAS 35590-72-8 appears in our catalog under these names: (3R,6S)-3-Methyl-6-(2-methylpropyl)piperazine-2,5-dione, 95%, (3R,6S)-3-Methyl-6-(2-methylpropyl)piperazine-2,5-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(3R,6S)-3-methyl-6-(2-methylpropyl)piperazine-2,5-dione (CAS 35590-72-8) is a chemical compound with the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. IUPAC name: (3R,6S)-3-methyl-6-(2-methylpropyl)piperazine-2,5-dione. InChIKey: DBJPZCJQDRPOME-RQJHMYQMSA-N.
| Molecular formula | C9H16N2O2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | (3R,6S)-3-methyl-6-(2-methylpropyl)piperazine-2,5-dione |
| InChIKey | DBJPZCJQDRPOME-RQJHMYQMSA-N |
| SMILES | C[C@@H]1C(=O)N[C@H](C(=O)N1)CC(C)C |
Computed by PubChem (NCBI)