Products 5845-58-9
CAS 5845-58-9 is the registry number for (3R,6R)-3-Methyl-6-(2-methylpropyl)piperazine-2,5-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3R,6R)-3-methyl-6-(2-methylpropyl)piperazine-2,5-dione (CAS 5845-58-9) is a chemical compound with the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. IUPAC name: (3R,6R)-3-methyl-6-(2-methylpropyl)piperazine-2,5-dione. InChIKey: DBJPZCJQDRPOME-RNFRBKRXSA-N.
| Molecular formula | C9H16N2O2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | (3R,6R)-3-methyl-6-(2-methylpropyl)piperazine-2,5-dione |
| InChIKey | DBJPZCJQDRPOME-RNFRBKRXSA-N |
| SMILES | C[C@@H]1C(=O)N[C@@H](C(=O)N1)CC(C)C |
Computed by PubChem (NCBI)