CAS 58456-48-7 is the registry number for 4-Pentyn-2-ol 4-Methylbenzenesulfonate. Offered by: TRC. Available pack sizes: 100mg, 1g, 250mg.
Pent-4-yn-2-yl 4-methylbenzenesulfonate (CAS 58456-48-7) is a chemical compound with the molecular formula C12H14O3S and a molecular weight of 238.30 g/mol. IUPAC name: pent-4-yn-2-yl 4-methylbenzenesulfonate. InChIKey: FUXZPGSGEZVNMH-UHFFFAOYSA-N.
| Molecular formula | C12H14O3S |
|---|---|
| Molecular weight | 238.30 g/mol |
| IUPAC name | pent-4-yn-2-yl 4-methylbenzenesulfonate |
| InChIKey | FUXZPGSGEZVNMH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC(C)CC#C |
Computed by PubChem (NCBI)