Products 58456-48-7

CAS 58456-48-7 is the registry number for 4-Pentyn-2-ol 4-Methylbenzenesulfonate. Offered by: TRC. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Pent-4-yn-2-yl 4-methylbenzenesulfonate (CAS 58456-48-7) is a chemical compound with the molecular formula C12H14O3S and a molecular weight of 238.30 g/mol. IUPAC name: pent-4-yn-2-yl 4-methylbenzenesulfonate. InChIKey: FUXZPGSGEZVNMH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O3S
Molecular weight238.30 g/mol
IUPAC namepent-4-yn-2-yl 4-methylbenzenesulfonate
InChIKeyFUXZPGSGEZVNMH-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OC(C)CC#C

Computed by PubChem (NCBI)