Products 80969-99-9

CAS 80969-99-9 is the registry number for (RS)-2-Acetylsulfanylmethyl-3-phenyl-propionic acid. Offered by: Creative Peptides. Available pack sizes: 50mg, 250mg.

Structural formula: {0} (CAS {1})

2-(acetylsulfanylmethyl)-3-phenylpropanoic acid (CAS 80969-99-9) is a chemical compound with the molecular formula C12H14O3S and a molecular weight of 238.30 g/mol. IUPAC name: 2-(acetylsulfanylmethyl)-3-phenylpropanoic acid. InChIKey: BCAAXVOKLXDSPD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O3S
Molecular weight238.30 g/mol
IUPAC name2-(acetylsulfanylmethyl)-3-phenylpropanoic acid
InChIKeyBCAAXVOKLXDSPD-UHFFFAOYSA-N
SMILESCC(=O)SCC(CC1=CC=CC=C1)C(=O)O

Computed by PubChem (NCBI)