CAS 58472-36-9 appears in our catalog under these names: 7-Fluoro-2-hydroxynaphthalene-1,4-dione, 95%, 7-Fluoro-2-hydroxynaphthalene-1,4-dione 95+%, 7-Fluoro-2-hydroxynaphthalene-1,4-dione, 95+%, 95+%, 7-Fluoro-2-hydroxynaphthalene-1,4-dione, 95+%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
7-fluoro-4-hydroxynaphthalene-1,2-dione (CAS 58472-36-9) is a chemical compound with the molecular formula C10H5FO3 and a molecular weight of 192.14 g/mol. IUPAC name: 7-fluoro-4-hydroxynaphthalene-1,2-dione. InChIKey: YSMKKMPXFYTUKK-UHFFFAOYSA-N.
| Molecular formula | C10H5FO3 |
|---|---|
| Molecular weight | 192.14 g/mol |
| IUPAC name | 7-fluoro-4-hydroxynaphthalene-1,2-dione |
| InChIKey | YSMKKMPXFYTUKK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=O)C(=O)C=C2O |
Computed by PubChem (NCBI)