CAS 848031-16-3 appears in our catalog under these names: 3-(2-Fluorophenyl)-2,5-dihydrofuran-2,5-dione, 3-(2-Fluorophenyl)-2,5-dihydrofuran-2,5-dione, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
3-(2-fluorophenyl)furan-2,5-dione (CAS 848031-16-3) is a chemical compound with the molecular formula C10H5FO3 and a molecular weight of 192.14 g/mol. IUPAC name: 3-(2-fluorophenyl)furan-2,5-dione. InChIKey: NENXSQJEVCAUSY-UHFFFAOYSA-N.
| Molecular formula | C10H5FO3 |
|---|---|
| Molecular weight | 192.14 g/mol |
| IUPAC name | 3-(2-fluorophenyl)furan-2,5-dione |
| InChIKey | NENXSQJEVCAUSY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=O)OC2=O)F |
Computed by PubChem (NCBI)