CAS 58498-11-6 appears in our catalog under these names: Picosulfate Impurity 8, 4-(Pyridin-2-ylmethyl)phenol, 95%. Offered by: Chemat Brand, AmBeed. Available pack sizes: on request, 1g.
4-(pyridin-2-ylmethyl)phenol (CAS 58498-11-6) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: 4-(pyridin-2-ylmethyl)phenol. InChIKey: FYKBHPFNYWJDFQ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 4-(pyridin-2-ylmethyl)phenol |
| InChIKey | FYKBHPFNYWJDFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)