CAS 58520-03-9 appears in our catalog under these names: (1R,2R)-1,2-Di(4'-methoxyphenyl)-1,2-diaminoethane, 95%, (1S,2S)-1,2-Di(4'-methoxyphenyl)-1,2-diaminoethane, 95%, (1R,2R)–Bis(4–methoxyphenyl)–1,2–ethanediamine, 1,2-Ethanediamine, 1,2-bis(4-methoxyphenyl)-, (1R,2R)-, 97%, ee99%, 97%, ee99%, (1R,2R)-1,2-Di(4'-methoxyphenyl)-1,2-diaminoethane, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 15g, 25g, 50g, 75g.
(1R,2R)-1,2-bis(4-methoxyphenyl)ethane-1,2-diamine (CAS 58520-03-9) is a chemical compound with the molecular formula C16H20N2O2 and a molecular weight of 272.34 g/mol. IUPAC name: (1R,2R)-1,2-bis(4-methoxyphenyl)ethane-1,2-diamine. InChIKey: ZWMPRHYHRAUVGY-HZPDHXFCSA-N.
| Molecular formula | C16H20N2O2 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | (1R,2R)-1,2-bis(4-methoxyphenyl)ethane-1,2-diamine |
| InChIKey | ZWMPRHYHRAUVGY-HZPDHXFCSA-N |
| SMILES | COC1=CC=C(C=C1)[C@H]([C@@H](C2=CC=C(C=C2)OC)N)N |
Computed by PubChem (NCBI)