CAS 58537-98-7 is the registry number for 4-tert-Butyl-2,6-dimethylbenzoic acid. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg.
4-tert-butyl-2,6-dimethylbenzoic acid (CAS 58537-98-7) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: 4-tert-butyl-2,6-dimethylbenzoic acid. InChIKey: BEVOWXHJERCALW-UHFFFAOYSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 4-tert-butyl-2,6-dimethylbenzoic acid |
| InChIKey | BEVOWXHJERCALW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)O)C)C(C)(C)C |
Computed by PubChem (NCBI)