Products 58537-98-7

CAS 58537-98-7 is the registry number for 4-tert-Butyl-2,6-dimethylbenzoic acid. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg.

Structural formula: {0} (CAS {1})

4-tert-butyl-2,6-dimethylbenzoic acid (CAS 58537-98-7) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: 4-tert-butyl-2,6-dimethylbenzoic acid. InChIKey: BEVOWXHJERCALW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18O2
Molecular weight206.28 g/mol
IUPAC name4-tert-butyl-2,6-dimethylbenzoic acid
InChIKeyBEVOWXHJERCALW-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1C(=O)O)C)C(C)(C)C

Computed by PubChem (NCBI)