Products 58590-42-4

CAS 58590-42-4 is the registry number for Metoclopramide Impurity 22. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-amino-3-chloro-2-methoxybenzoic acid (CAS 58590-42-4) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: 4-amino-3-chloro-2-methoxybenzoic acid. InChIKey: PBHNGVWDZZLXHD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClNO3
Molecular weight201.61 g/mol
IUPAC name4-amino-3-chloro-2-methoxybenzoic acid
InChIKeyPBHNGVWDZZLXHD-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1Cl)N)C(=O)O

Computed by PubChem (NCBI)