Products 58620-63-6
CAS 58620-63-6 is the registry number for ethyl trans-2-(2-pyridyl)cyclopropanecarboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Trans-ethyl (1R,2R)-2-pyridin-2-ylcyclopropane-1-carboxylate (CAS 58620-63-6) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: trans-ethyl (1R,2R)-2-pyridin-2-ylcyclopropane-1-carboxylate. InChIKey: FLUXXOZZARUHSQ-RKDXNWHRSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | trans-ethyl (1R,2R)-2-pyridin-2-ylcyclopropane-1-carboxylate |
| InChIKey | FLUXXOZZARUHSQ-RKDXNWHRSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@H]1C2=CC=CC=N2 |
Computed by PubChem (NCBI)