Products 586410-12-0
CAS 586410-12-0 is the registry number for cis-3,4',5-Trimethoxy-3'-aminostilbene. Offered by: TRC. Available pack sizes: 250mg.
5-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyaniline (CAS 586410-12-0) is a chemical compound with the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. IUPAC name: 5-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyaniline. InChIKey: OEQWGVQMUXYOJC-PLNGDYQASA-N.
| Molecular formula | C17H19NO3 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | 5-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyaniline |
| InChIKey | OEQWGVQMUXYOJC-PLNGDYQASA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C\C2=CC(=CC(=C2)OC)OC)N |
Computed by PubChem (NCBI)