CAS 5868-54-2 is the registry number for 3-Phenylisoxazole-5-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
(3-phenyl-1,2-oxazol-5-yl)boronic acid (CAS 5868-54-2) is a chemical compound with the molecular formula C9H8BNO3 and a molecular weight of 188.98 g/mol. IUPAC name: (3-phenyl-1,2-oxazol-5-yl)boronic acid. InChIKey: VEJIQHRMIYFYPS-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO3 |
|---|---|
| Molecular weight | 188.98 g/mol |
| IUPAC name | (3-phenyl-1,2-oxazol-5-yl)boronic acid |
| InChIKey | VEJIQHRMIYFYPS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NO1)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)