CAS 902775-28-4 appears in our catalog under these names: [3-(1,3-Oxazol-5-yl)phenyl]boronic acid, 98%, (3-(1,3-Oxazol-5-yl)phenyl)boronic acid, (3-(Oxazol-5-yl)phenyl)boronic acid 98%, (3-(Oxazol-5-yl)phenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
[3-(1,3-oxazol-5-yl)phenyl]boronic acid (CAS 902775-28-4) is a chemical compound with the molecular formula C9H8BNO3 and a molecular weight of 188.98 g/mol. IUPAC name: [3-(1,3-oxazol-5-yl)phenyl]boronic acid. InChIKey: SOFRWUFTUVHYQR-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO3 |
|---|---|
| Molecular weight | 188.98 g/mol |
| IUPAC name | [3-(1,3-oxazol-5-yl)phenyl]boronic acid |
| InChIKey | SOFRWUFTUVHYQR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=CN=CO2)(O)O |
Computed by PubChem (NCBI)