CAS 587-34-8 is the registry number for 3-(3-Chlorophenyl)-1,1-dimethylurea. Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
3-(3-chlorophenyl)-1,1-dimethylurea (CAS 587-34-8) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 3-(3-chlorophenyl)-1,1-dimethylurea. InChIKey: QLQDWOFJALEHSP-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-1,1-dimethylurea |
| InChIKey | QLQDWOFJALEHSP-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)NC1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)