CAS 58730-43-1 appears in our catalog under these names: 2-(3-Aminophenyl)-n,n-dimethylacetamide, 96%, 2-(3-aminophenyl)-N,N-dimethylacetamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g, 2g, 25g.
2-(3-aminophenyl)-N,N-dimethylacetamide (CAS 58730-43-1) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. IUPAC name: 2-(3-aminophenyl)-N,N-dimethylacetamide. InChIKey: UWEZXIIXUNXITL-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 2-(3-aminophenyl)-N,N-dimethylacetamide |
| InChIKey | UWEZXIIXUNXITL-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CC1=CC(=CC=C1)N |
Computed by PubChem (NCBI)