Products 58777-65-4

CAS 58777-65-4 is the registry number for 4-Bromothiophene-2-carbonyl chloride 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-bromothiophene-2-carbonyl chloride (CAS 58777-65-4) is a chemical compound with the molecular formula C5H2BrClOS and a molecular weight of 225.49 g/mol. IUPAC name: 4-bromothiophene-2-carbonyl chloride. InChIKey: ZFFUAQAMUIHRON-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2BrClOS
Molecular weight225.49 g/mol
IUPAC name4-bromothiophene-2-carbonyl chloride
InChIKeyZFFUAQAMUIHRON-UHFFFAOYSA-N
SMILESC1=C(SC=C1Br)C(=O)Cl

Computed by PubChem (NCBI)