Products 72899-51-5

CAS 72899-51-5 appears in our catalog under these names: 4-Bromothiophene-3-carbonyl chloride, 95%, 4-Bromothiophene-3-carbonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g.

4-bromothiophene-3-carbonyl chloride (CAS 72899-51-5) is a chemical compound with the molecular formula C5H2BrClOS and a molecular weight of 225.49 g/mol. IUPAC name: 4-bromothiophene-3-carbonyl chloride. InChIKey: RAEMKVHFZZHQSI-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2BrClOS
Molecular weight225.49 g/mol
IUPAC name4-bromothiophene-3-carbonyl chloride
InChIKeyRAEMKVHFZZHQSI-UHFFFAOYSA-N
SMILESC1=C(C(=CS1)Br)C(=O)Cl

Computed by PubChem (NCBI)