Products 58788-79-7
CAS 58788-79-7 is the registry number for 4,4'-(Adamantane-1,3-diyl)dianiline, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
4-[3-(4-aminophenyl)-1-adamantyl]aniline (CAS 58788-79-7) is a chemical compound with the molecular formula C22H26N2 and a molecular weight of 318.5 g/mol. IUPAC name: 4-[3-(4-aminophenyl)-1-adamantyl]aniline. InChIKey: LALHUWOVOZGIAW-UHFFFAOYSA-N.
| Molecular formula | C22H26N2 |
|---|---|
| Molecular weight | 318.5 g/mol |
| IUPAC name | 4-[3-(4-aminophenyl)-1-adamantyl]aniline |
| InChIKey | LALHUWOVOZGIAW-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)C4=CC=C(C=C4)N)C5=CC=C(C=C5)N |
Computed by PubChem (NCBI)