Products 588-17-0
CAS 588-17-0 is the registry number for Neostigmine (hydroxide). Offered by: MedChemExpress. Available pack sizes: Get quote.
[3-(dimethylcarbamoyloxy)phenyl]-trimethylazanium hydroxide (CAS 588-17-0) is a chemical compound with the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. IUPAC name: [3-(dimethylcarbamoyloxy)phenyl]-trimethylazanium hydroxide. InChIKey: GTPJMRHVDZUPND-UHFFFAOYSA-M.
| Molecular formula | C12H20N2O3 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | [3-(dimethylcarbamoyloxy)phenyl]-trimethylazanium hydroxide |
| InChIKey | GTPJMRHVDZUPND-UHFFFAOYSA-M |
| SMILES | CN(C)C(=O)OC1=CC=CC(=C1)[N+](C)(C)C.[OH-] |
Computed by PubChem (NCBI)