CAS 58802-20-3 is the registry number for 1,2,7,8-Tetrachlorodibenzofuran. Offered by: TRC. Available pack sizes: 25mg.
1,2,7,8-tetrachlorodibenzofuran (CAS 58802-20-3) is a chemical compound with the molecular formula C12H4Cl4O and a molecular weight of 306.0 g/mol. IUPAC name: 1,2,7,8-tetrachlorodibenzofuran. InChIKey: JODWPAQNABOHDG-UHFFFAOYSA-N.
| Molecular formula | C12H4Cl4O |
|---|---|
| Molecular weight | 306.0 g/mol |
| IUPAC name | 1,2,7,8-tetrachlorodibenzofuran |
| InChIKey | JODWPAQNABOHDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1OC3=CC(=C(C=C32)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)